![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| UG-ECE-Curriculum structure_3rd to 8th semester_program samples.pdf | 2023-02-07 12:13 | 283K | |
| BE Civil -Scheme and Syllabi of 3rd to 8th semester_program sample.pdf | 2023-02-07 12:13 | 515K | |
| 2nd Sem B.E. 2019-20 Curriculum Structure.jpeg | 2023-02-07 12:13 | 570K | |
| 1st Sem B.E. 2019-20 Curriculum Structure.jpeg | 2023-02-07 12:13 | 578K | |
| 2.3.1_Social Innovation Tour Guide.pdf | 2023-02-07 12:13 | 2.0M | |
| 2.3.1_Minor Projects_CVE.pdf | 2023-02-07 12:13 | 2.8M | |
| 2.3.1_Mini Project_CVE.pdf | 2023-02-07 12:13 | 3.0M | |
| 1.Capstone_ECE.pdf | 2023-02-07 12:13 | 3.6M | |
| 2.3.1_Capstone Project_CVE.pdf | 2023-02-07 12:13 | 4.2M | |
| 1. Mini__ECE.pdf | 2023-02-07 12:13 | 4.9M | |
| 1.Minor__ECE.pdf | 2023-02-07 12:13 | 7.9M | |
| 1.Project_ Mini_Minor_Capstone_ECE.pdf | 2023-02-07 12:13 | 16M | |
| 2.3.1_CEER_Project Details_Sample.pdf | 2023-02-07 12:13 | 23M | |
| Course Project Details-SoCSE.pdf | 2023-02-07 12:13 | 55M | |