![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Course Project Details-SoCSE.pdf | 2023-02-07 12:13 | 55M | |
![[ ]](/icons/layout.gif) | 2.3.1_CEER_Project Details_Sample.pdf | 2023-02-07 12:13 | 23M | |
![[ ]](/icons/layout.gif) | 1.Project_ Mini_Minor_Capstone_ECE.pdf | 2023-02-07 12:13 | 16M | |
![[ ]](/icons/layout.gif) | 1.Minor__ECE.pdf | 2023-02-07 12:13 | 7.9M | |
![[ ]](/icons/layout.gif) | 1. Mini__ECE.pdf | 2023-02-07 12:13 | 4.9M | |
![[ ]](/icons/layout.gif) | 2.3.1_Capstone Project_CVE.pdf | 2023-02-07 12:13 | 4.2M | |
![[ ]](/icons/layout.gif) | 1.Capstone_ECE.pdf | 2023-02-07 12:13 | 3.6M | |
![[ ]](/icons/layout.gif) | 2.3.1_Mini Project_CVE.pdf | 2023-02-07 12:13 | 3.0M | |
![[ ]](/icons/layout.gif) | 2.3.1_Minor Projects_CVE.pdf | 2023-02-07 12:13 | 2.8M | |
![[ ]](/icons/layout.gif) | 2.3.1_Social Innovation Tour Guide.pdf | 2023-02-07 12:13 | 2.0M | |
![[IMG]](/icons/image2.gif) | 1st Sem B.E. 2019-20 Curriculum Structure.jpeg | 2023-02-07 12:13 | 578K | |
![[IMG]](/icons/image2.gif) | 2nd Sem B.E. 2019-20 Curriculum Structure.jpeg | 2023-02-07 12:13 | 570K | |
![[ ]](/icons/layout.gif) | BE Civil -Scheme and Syllabi of 3rd to 8th semester_program sample.pdf | 2023-02-07 12:13 | 515K | |
![[ ]](/icons/layout.gif) | UG-ECE-Curriculum structure_3rd to 8th semester_program samples.pdf | 2023-02-07 12:13 | 283K | |
|