![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 17.Structure of the program 2019-20 SMSR.pdf | 2023-02-07 12:13 | 3.0M | |
| 16.BoS approved Structure of MCA Programme from 2019-22.pdf | 2023-02-07 12:13 | 200K | |
| 15. Curriculum structures.pdf | 2023-02-07 12:13 | 12M | |
| 14._SME_Curriculum structure_PG_ESE_BOS_2019-20.pdf | 2023-02-07 12:13 | 404K | |
| 13.SME_Curriculum structure_PG_PM_BOS_2019-20.pdf | 2023-02-07 12:13 | 607K | |
| 12._SME_Curriculum structure_PG_MD_BOS_2019-20.pdf | 2023-02-07 12:13 | 475K | |
| 11..PG DE _C.pdf | 2023-02-07 12:13 | 1.0M | |
| 10..PG VDES _.pdf | 2023-02-07 12:13 | 1.6M | |
| 9.Structural .pdf | 2023-02-07 12:13 | 47M | |
| 8.Arch based credit system.pdf | 2023-02-07 12:13 | 169K | |
| 7.bt.pdf | 2023-02-07 12:13 | 11M | |
| 6.ar.pdf | 2023-02-07 12:13 | 2.4M | |
| 5. Civil - 2015-19_2016-20_Structure.pdf | 2023-02-07 12:13 | 892K | |
| 4.ee2019-20.pdf | 2023-02-07 12:13 | 3.2M | |
| 3.SME__BOS_2019-20.pdf | 2023-02-07 12:13 | 287K | |
| 2.ec.pdf | 2023-02-07 12:13 | 9.7M | |
| 1.socse.pdf | 2023-02-07 12:13 | 47M | |
| 0.i year Scheme & Syllabus 2019-20 First Year BE.pdf | 2023-02-07 12:13 | 2.1M | |